C12H22FN — CID 143750157
(3Z,5Z)-4-ethyl-7-fluorohepta-1,3,5-triene;N-methylethanamine (PubChem CID 143750157) has the molecular formula C12H22FN and a molecular weight of 199.31 g/mol. Its IUPAC name is (3Z,5Z)-4-ethyl-7-fluorohepta-1,3,5-triene;N-methylethanamine.
| Compound Name | (3Z,5Z)-4-ethyl-7-fluorohepta-1,3,5-triene;N-methylethanamine |
|---|---|
| PubChem CID | 143750157 |
| Molecular Formula | C12H22FN |
| Molecular Weight | 199.31 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | (3Z,5Z)-4-ethyl-7-fluorohepta-1,3,5-triene;N-methylethanamine |
| SMILES | C=C/C=C(\C=C/CF)CC.CCNC |
| InChI | InChI=1S/C9H13F.C3H9N/c1-3-6-9(4-2)7-5-8-10;1-3-4-2/h3,5-7H,1,4,8H2,2H3;4H,3H2,1-2H3/b7-5-,9-6-; |
| InChIKey | OGIYBTHQVUUGOK-ORYMYBSFSA-N |
| XLogP | 3.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|