C16H25N — CID 167457631
(6Z,7Z)-6-prop-2-enylidene-N-propyldeca-1,7,9-trien-2-amine (PubChem CID 167457631) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is (6Z,7Z)-6-prop-2-enylidene-N-propyldeca-1,7,9-trien-2-amine.
| Compound Name | (6Z,7Z)-6-prop-2-enylidene-N-propyldeca-1,7,9-trien-2-amine |
|---|---|
| PubChem CID | 167457631 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | (6Z,7Z)-6-prop-2-enylidene-N-propyldeca-1,7,9-trien-2-amine |
| SMILES | C=C/C=C\C(=C/C=C)CCCC(=C)NCCC |
| InChI | InChI=1S/C16H25N/c1-5-8-12-16(10-6-2)13-9-11-15(4)17-14-7-3/h5-6,8,10,12,17H,1-2,4,7,9,11,13-14H2,3H3/b12-8-,16-10+ |
| InChIKey | WSJOORZPUKVNOO-UMSWYRGBSA-N |
| XLogP | 4.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|