C21H34O2 — CID 142817556
ethane;[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxymethylbenzene;propanal (PubChem CID 142817556) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is ethane;[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxymethylbenzene;propanal.
| Compound Name | ethane;[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxymethylbenzene;propanal |
|---|---|
| PubChem CID | 142817556 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | ethane;[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxymethylbenzene;propanal |
| SMILES | C=C/C=C\C(=C/C)OCc1ccccc1.CC.CC.CCC=O |
| InChI | InChI=1S/C14H16O.C3H6O.2C2H6/c1-3-5-11-14(4-2)15-12-13-9-7-6-8-10-13;1-2-3-4;2*1-2/h3-11H,1,12H2,2H3;3H,2H2,1H3;2*1-2H3/b11-5-,14-4+;;; |
| InChIKey | PNCGYJJXTPCAKT-YHCUBVGXSA-N |
| XLogP | 6.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|