C15H17NO2 — CID 178142663
benzyl (2E)-2-[(E)-1-aminoprop-1-enyl]penta-2,4-dienoate (PubChem CID 178142663) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is benzyl (2E)-2-[(E)-1-aminoprop-1-enyl]penta-2,4-dienoate.
| Compound Name | benzyl (2E)-2-[(E)-1-aminoprop-1-enyl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 178142663 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | benzyl (2E)-2-[(E)-1-aminoprop-1-enyl]penta-2,4-dienoate |
| SMILES | C=C/C=C(C(=O)OCc1ccccc1)\C(N)=C/C |
| InChI | InChI=1S/C15H17NO2/c1-3-8-13(14(16)4-2)15(17)18-11-12-9-6-5-7-10-12/h3-10H,1,11,16H2,2H3/b13-8+,14-4+ |
| InChIKey | FFHKUWROJOBHMA-WVPIJKBQSA-N |
| XLogP | 2.70 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|