C9H14O — CID 142113111
(3Z,5E)-2-methoxy-5-methylhepta-1,3,5-triene (PubChem CID 142113111) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is (3Z,5E)-2-methoxy-5-methylhepta-1,3,5-triene.
| Compound Name | (3Z,5E)-2-methoxy-5-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 142113111 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | (3Z,5E)-2-methoxy-5-methylhepta-1,3,5-triene |
| SMILES | C=C(/C=C\C(C)=C\C)OC |
| InChI | InChI=1S/C9H14O/c1-5-8(2)6-7-9(3)10-4/h5-7H,3H2,1-2,4H3/b7-6-,8-5+ |
| InChIKey | QBNYKVROTAKWNZ-WNXMRAAYSA-N |
| XLogP | 2.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|