C6H7O2Y- — CID 59884469
(2E)-4-methoxypenta-2,4-dien-1-one;yttrium (PubChem CID 59884469) has the molecular formula C6H7O2Y- and a molecular weight of 200.03 g/mol. Its IUPAC name is (2E)-4-methoxypenta-2,4-dien-1-one;yttrium.
| Compound Name | (2E)-4-methoxypenta-2,4-dien-1-one;yttrium |
|---|---|
| PubChem CID | 59884469 |
| Molecular Formula | C6H7O2Y- |
| Molecular Weight | 200.03 g/mol |
| Exact Mass | 199.95 |
| IUPAC Name | (2E)-4-methoxypenta-2,4-dien-1-one;yttrium |
| SMILES | C=C(/C=C/[C-]=O)OC.[Y] |
| InChI | InChI=1S/C6H7O2.Y/c1-6(8-2)4-3-5-7;/h3-4H,1H2,2H3;/q-1;/b4-3+; |
| InChIKey | ADVXDHOILRCBEQ-BJILWQEISA-N |
| XLogP | 0.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.03 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|