About ethane;(3Z)-2-methoxy-5-methylhexa-1,3,5-triene
ethane;(3Z)-2-methoxy-5-methylhexa-1,3,5-triene (PubChem CID 144626557) has the molecular formula C12H24O
and a molecular weight of 184.32 g/mol. Its IUPAC name is ethane;(3Z)-2-methoxy-5-methylhexa-1,3,5-triene.
Molecular Properties
| Compound Name | ethane;(3Z)-2-methoxy-5-methylhexa-1,3,5-triene |
| PubChem CID | 144626557 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | ethane;(3Z)-2-methoxy-5-methylhexa-1,3,5-triene |
| SMILES | C=C(C)/C=C\C(=C)OC.CC.CC |
| InChI | InChI=1S/C8H12O.2C2H6/c1-7(2)5-6-8(3)9-4;2*1-2/h5-6H,1,3H2,2,4H3;2*1-2H3/b6-5-;; |
| InChIKey | YGJVQYCJBIEKAI-XNOMRPDFSA-N |
| XLogP | 4.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(3Z)-2-methoxy-5-methylhexa-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3Z)-2-methoxy-5-methylhexa-1,3,5-triene?
The IUPAC name of ethane;(3Z)-2-methoxy-5-methylhexa-1,3,5-triene (CID 144626557) is ethane;(3Z)-2-methoxy-5-methylhexa-1,3,5-triene.
What is the SMILES notation for ethane;(3Z)-2-methoxy-5-methylhexa-1,3,5-triene?
The canonical SMILES for ethane;(3Z)-2-methoxy-5-methylhexa-1,3,5-triene is C=C(C)/C=C\C(=C)OC.CC.CC.
What is the InChIKey of ethane;(3Z)-2-methoxy-5-methylhexa-1,3,5-triene?
The InChIKey is YGJVQYCJBIEKAI-XNOMRPDFSA-N. The full InChI is InChI=1S/C8H12O.2C2H6/c1-7(2)5-6-8(3)9-4;2*1-2/h5-6H,1,3H2,2,4H3;2*1-2H3/b6-5-;;.
What are the key properties of ethane;(3Z)-2-methoxy-5-methylhexa-1,3,5-triene?
ethane;(3Z)-2-methoxy-5-methylhexa-1,3,5-triene has a molecular weight of 184.32 g/mol, XLogP of 4.33, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3Z)-2-methoxy-5-methylhexa-1,3,5-triene is sourced from PubChem (CID 144626557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).