C12H24O — CID 144626557
ethane;(3Z)-2-methoxy-5-methylhexa-1,3,5-triene (PubChem CID 144626557) has the molecular formula C12H24O and a molecular weight of 184.32 g/mol. Its IUPAC name is ethane;(3Z)-2-methoxy-5-methylhexa-1,3,5-triene.
| Compound Name | ethane;(3Z)-2-methoxy-5-methylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 144626557 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | ethane;(3Z)-2-methoxy-5-methylhexa-1,3,5-triene |
| SMILES | C=C(C)/C=C\C(=C)OC.CC.CC |
| InChI | InChI=1S/C8H12O.2C2H6/c1-7(2)5-6-8(3)9-4;2*1-2/h5-6H,1,3H2,2,4H3;2*1-2H3/b6-5-;; |
| InChIKey | YGJVQYCJBIEKAI-XNOMRPDFSA-N |
| XLogP | 4.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|