C9H16OS — CID 143643726
ethane;(3Z)-5-methoxyhexa-1,3,5-triene-2-thiol (PubChem CID 143643726) has the molecular formula C9H16OS and a molecular weight of 172.29 g/mol. Its IUPAC name is ethane;(3Z)-5-methoxyhexa-1,3,5-triene-2-thiol.
| Compound Name | ethane;(3Z)-5-methoxyhexa-1,3,5-triene-2-thiol |
|---|---|
| PubChem CID | 143643726 |
| Molecular Formula | C9H16OS |
| Molecular Weight | 172.29 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | ethane;(3Z)-5-methoxyhexa-1,3,5-triene-2-thiol |
| SMILES | C=C(S)/C=C\C(=C)OC.CC |
| InChI | InChI=1S/C7H10OS.C2H6/c1-6(8-3)4-5-7(2)9;1-2/h4-5,9H,1-2H2,3H3;1-2H3/b5-4-; |
| InChIKey | XRZTXBVNDXTXDL-MKWAYWHRSA-N |
| XLogP | 3.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|