C7H11NS — CID 89418541
(3Z,5Z)-7-aminohepta-1,3,5-triene-2-thiol (PubChem CID 89418541) has the molecular formula C7H11NS and a molecular weight of 141.24 g/mol. Its IUPAC name is (3Z,5Z)-7-aminohepta-1,3,5-triene-2-thiol.
| Compound Name | (3Z,5Z)-7-aminohepta-1,3,5-triene-2-thiol |
|---|---|
| PubChem CID | 89418541 |
| Molecular Formula | C7H11NS |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | (3Z,5Z)-7-aminohepta-1,3,5-triene-2-thiol |
| SMILES | C=C(S)/C=C\C=C/CN |
| InChI | InChI=1S/C7H11NS/c1-7(9)5-3-2-4-6-8/h2-5,9H,1,6,8H2/b4-2-,5-3- |
| InChIKey | CALZSHIEIDTVPA-JVLMNHKTSA-N |
| XLogP | 1.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|