C9H12S — CID 144863707
(3Z)-hexa-1,3,5-triene-2-thiol;propa-1,2-diene (PubChem CID 144863707) has the molecular formula C9H12S and a molecular weight of 152.26 g/mol. Its IUPAC name is (3Z)-hexa-1,3,5-triene-2-thiol;propa-1,2-diene.
| Compound Name | (3Z)-hexa-1,3,5-triene-2-thiol;propa-1,2-diene |
|---|---|
| PubChem CID | 144863707 |
| Molecular Formula | C9H12S |
| Molecular Weight | 152.26 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | (3Z)-hexa-1,3,5-triene-2-thiol;propa-1,2-diene |
| SMILES | C=C/C=C\C(=C)S.C=C=C |
| InChI | InChI=1S/C6H8S.C3H4/c1-3-4-5-6(2)7;1-3-2/h3-5,7H,1-2H2;1-2H2/b5-4-; |
| InChIKey | LINDWTQIFZHPBQ-MKWAYWHRSA-N |
| XLogP | 3.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|