About (3Z)-hexa-1,3,5-triene-2-thiol;propa-1,2-diene
(3Z)-hexa-1,3,5-triene-2-thiol;propa-1,2-diene (PubChem CID 144863707) has the molecular formula C9H12S
and a molecular weight of 152.26 g/mol. Its IUPAC name is (3Z)-hexa-1,3,5-triene-2-thiol;propa-1,2-diene.
Molecular Properties
| Compound Name | (3Z)-hexa-1,3,5-triene-2-thiol;propa-1,2-diene |
| PubChem CID | 144863707 |
| Molecular Formula | C9H12S |
| Molecular Weight | 152.26 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | (3Z)-hexa-1,3,5-triene-2-thiol;propa-1,2-diene |
| SMILES | C=C/C=C\C(=C)S.C=C=C |
| InChI | InChI=1S/C6H8S.C3H4/c1-3-4-5-6(2)7;1-3-2/h3-5,7H,1-2H2;1-2H2/b5-4-; |
| InChIKey | LINDWTQIFZHPBQ-MKWAYWHRSA-N |
| XLogP | 3.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-hexa-1,3,5-triene-2-thiol;propa-1,2-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-hexa-1,3,5-triene-2-thiol;propa-1,2-diene?
The IUPAC name of (3Z)-hexa-1,3,5-triene-2-thiol;propa-1,2-diene (CID 144863707) is (3Z)-hexa-1,3,5-triene-2-thiol;propa-1,2-diene.
What is the SMILES notation for (3Z)-hexa-1,3,5-triene-2-thiol;propa-1,2-diene?
The canonical SMILES for (3Z)-hexa-1,3,5-triene-2-thiol;propa-1,2-diene is C=C/C=C\C(=C)S.C=C=C.
What is the InChIKey of (3Z)-hexa-1,3,5-triene-2-thiol;propa-1,2-diene?
The InChIKey is LINDWTQIFZHPBQ-MKWAYWHRSA-N. The full InChI is InChI=1S/C6H8S.C3H4/c1-3-4-5-6(2)7;1-3-2/h3-5,7H,1-2H2;1-2H2/b5-4-;.
What are the key properties of (3Z)-hexa-1,3,5-triene-2-thiol;propa-1,2-diene?
(3Z)-hexa-1,3,5-triene-2-thiol;propa-1,2-diene has a molecular weight of 152.26 g/mol, XLogP of 3.13, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-hexa-1,3,5-triene-2-thiol;propa-1,2-diene is sourced from PubChem (CID 144863707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).