C7H9FS — CID 155374240
(3Z,5Z)-7-fluorohepta-1,3,5-triene-2-thiol (PubChem CID 155374240) has the molecular formula C7H9FS and a molecular weight of 144.21 g/mol. Its IUPAC name is (3Z,5Z)-7-fluorohepta-1,3,5-triene-2-thiol.
| Compound Name | (3Z,5Z)-7-fluorohepta-1,3,5-triene-2-thiol |
|---|---|
| PubChem CID | 155374240 |
| Molecular Formula | C7H9FS |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | (3Z,5Z)-7-fluorohepta-1,3,5-triene-2-thiol |
| SMILES | C=C(S)/C=C\C=C/CF |
| InChI | InChI=1S/C7H9FS/c1-7(9)5-3-2-4-6-8/h2-5,9H,1,6H2/b4-2-,5-3- |
| InChIKey | GSAMLYPSAKPGQQ-JVLMNHKTSA-N |
| XLogP | 2.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|