C6H7F3 — CID 173439953
1,1,6-trifluorohexa-2,4-diene (PubChem CID 173439953) has the molecular formula C6H7F3 and a molecular weight of 136.12 g/mol. Its IUPAC name is 1,1,6-trifluorohexa-2,4-diene.
| Compound Name | 1,1,6-trifluorohexa-2,4-diene |
|---|---|
| PubChem CID | 173439953 |
| Molecular Formula | C6H7F3 |
| Molecular Weight | 136.12 g/mol |
| Exact Mass | 136.05 |
| IUPAC Name | 1,1,6-trifluorohexa-2,4-diene |
| SMILES | FCC=CC=CC(F)F |
| InChI | InChI=1S/C6H7F3/c7-5-3-1-2-4-6(8)9/h1-4,6H,5H2 |
| InChIKey | UHOWESNUNGXVKW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.12 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|