C7H11FO — CID 118612602
(1E,3Z)-5-fluoro-1-methoxyhexa-1,3-diene (PubChem CID 118612602) has the molecular formula C7H11FO and a molecular weight of 130.16 g/mol. Its IUPAC name is (1E,3Z)-5-fluoro-1-methoxyhexa-1,3-diene.
| Compound Name | (1E,3Z)-5-fluoro-1-methoxyhexa-1,3-diene |
|---|---|
| PubChem CID | 118612602 |
| Molecular Formula | C7H11FO |
| Molecular Weight | 130.16 g/mol |
| Exact Mass | 130.08 |
| IUPAC Name | (1E,3Z)-5-fluoro-1-methoxyhexa-1,3-diene |
| SMILES | CO/C=C/C=C\C(C)F |
| InChI | InChI=1S/C7H11FO/c1-7(8)5-3-4-6-9-2/h3-7H,1-2H3/b5-3-,6-4+ |
| InChIKey | ODYNPQYRYIXDKQ-CIIODKQPSA-N |
| XLogP | 2.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.16 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|