C9H13F — CID 88997135
(2Z,4Z,6E,8S)-8-fluoronona-2,4,6-triene (PubChem CID 88997135) has the molecular formula C9H13F and a molecular weight of 140.20 g/mol. Its IUPAC name is (2Z,4Z,6E,8S)-8-fluoronona-2,4,6-triene.
| Compound Name | (2Z,4Z,6E,8S)-8-fluoronona-2,4,6-triene |
|---|---|
| PubChem CID | 88997135 |
| Molecular Formula | C9H13F |
| Molecular Weight | 140.20 g/mol |
| Exact Mass | 140.10 |
| IUPAC Name | (2Z,4Z,6E,8S)-8-fluoronona-2,4,6-triene |
| SMILES | C/C=C\C=C/C=C/[C@H](C)F |
| InChI | InChI=1S/C9H13F/c1-3-4-5-6-7-8-9(2)10/h3-9H,1-2H3/b4-3-,6-5-,8-7+/t9-/m0/s1 |
| InChIKey | QRZAJVMQFFVTQJ-WTPVVKDRSA-N |
| XLogP | 3.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.20 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|