C8H10F2 — CID 142242814
(1E,6Z)-1,3-difluoroocta-1,4,6-triene (PubChem CID 142242814) has the molecular formula C8H10F2 and a molecular weight of 144.16 g/mol. Its IUPAC name is (1E,6Z)-1,3-difluoroocta-1,4,6-triene.
| Compound Name | (1E,6Z)-1,3-difluoroocta-1,4,6-triene |
|---|---|
| PubChem CID | 142242814 |
| Molecular Formula | C8H10F2 |
| Molecular Weight | 144.16 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | (1E,6Z)-1,3-difluoroocta-1,4,6-triene |
| SMILES | C/C=C\C=CC(F)/C=C/F |
| InChI | InChI=1S/C8H10F2/c1-2-3-4-5-8(10)6-7-9/h2-8H,1H3/b3-2-,5-4?,7-6+ |
| InChIKey | VLSFDLJMJKDXEI-DZBZBDAMSA-N |
| XLogP | 2.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.16 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|