C10H16FN — CID 164587800
(2E,7Z)-6-fluoro-N-methylnona-2,4,7-trien-1-amine (PubChem CID 164587800) has the molecular formula C10H16FN and a molecular weight of 169.24 g/mol. Its IUPAC name is (2E,7Z)-6-fluoro-N-methylnona-2,4,7-trien-1-amine.
| Compound Name | (2E,7Z)-6-fluoro-N-methylnona-2,4,7-trien-1-amine |
|---|---|
| PubChem CID | 164587800 |
| Molecular Formula | C10H16FN |
| Molecular Weight | 169.24 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | (2E,7Z)-6-fluoro-N-methylnona-2,4,7-trien-1-amine |
| SMILES | C/C=C\C(F)C=C/C=C/CNC |
| InChI | InChI=1S/C10H16FN/c1-3-7-10(11)8-5-4-6-9-12-2/h3-8,10,12H,9H2,1-2H3/b6-4+,7-3-,8-5? |
| InChIKey | VFLJDGNKGDRIHW-INRCQJGUSA-N |
| XLogP | 2.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|