C9H19N — CID 131243211
(E)-N,4-dimethylhept-2-en-1-amine (PubChem CID 131243211) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is (E)-N,4-dimethylhept-2-en-1-amine.
| Compound Name | (E)-N,4-dimethylhept-2-en-1-amine |
|---|---|
| PubChem CID | 131243211 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | (E)-N,4-dimethylhept-2-en-1-amine |
| SMILES | CCCC(C)/C=C/CNC |
| InChI | InChI=1S/C9H19N/c1-4-6-9(2)7-5-8-10-3/h5,7,9-10H,4,6,8H2,1-3H3/b7-5+ |
| InChIKey | BFVHWCVFEUYDSG-FNORWQNLSA-N |
| XLogP | 2.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|