C10H20 — CID 101420891
(E,5S)-5-methylnon-3-ene (PubChem CID 101420891) has the molecular formula C10H20 and a molecular weight of 140.27 g/mol. Its IUPAC name is (E,5S)-5-methylnon-3-ene.
| Compound Name | (E,5S)-5-methylnon-3-ene |
|---|---|
| PubChem CID | 101420891 |
| Molecular Formula | C10H20 |
| Molecular Weight | 140.27 g/mol |
| Exact Mass | 140.16 |
| IUPAC Name | (E,5S)-5-methylnon-3-ene |
| SMILES | CC/C=C/[C@@H](C)CCCC |
| InChI | InChI=1S/C10H20/c1-4-6-8-10(3)9-7-5-2/h6,8,10H,4-5,7,9H2,1-3H3/b8-6+/t10-/m1/s1 |
| InChIKey | RYBGNROWMIQGHS-QEHWCHDUSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|