C8H18N2 — CID 171552385
(Z)-N-methyl-N'-propan-2-ylbut-2-ene-1,4-diamine (PubChem CID 171552385) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is (Z)-N-methyl-N'-propan-2-ylbut-2-ene-1,4-diamine.
| Compound Name | (Z)-N-methyl-N'-propan-2-ylbut-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 171552385 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | (Z)-N-methyl-N'-propan-2-ylbut-2-ene-1,4-diamine |
| SMILES | CNC/C=C\CNC(C)C |
| InChI | InChI=1S/C8H18N2/c1-8(2)10-7-5-4-6-9-3/h4-5,8-10H,6-7H2,1-3H3/b5-4- |
| InChIKey | SAOMEPQEGMYXEX-PLNGDYQASA-N |
| XLogP | 0.76 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|