About (Z)-N-methyl-N'-propan-2-ylbut-2-ene-1,4-diamine
(Z)-N-methyl-N'-propan-2-ylbut-2-ene-1,4-diamine (PubChem CID 171552385) has the molecular formula C8H18N2
and a molecular weight of 142.25 g/mol. Its IUPAC name is (Z)-N-methyl-N'-propan-2-ylbut-2-ene-1,4-diamine.
Molecular Properties
| Compound Name | (Z)-N-methyl-N'-propan-2-ylbut-2-ene-1,4-diamine |
| PubChem CID | 171552385 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | (Z)-N-methyl-N'-propan-2-ylbut-2-ene-1,4-diamine |
| SMILES | CNC/C=C\CNC(C)C |
| InChI | InChI=1S/C8H18N2/c1-8(2)10-7-5-4-6-9-3/h4-5,8-10H,6-7H2,1-3H3/b5-4- |
| InChIKey | SAOMEPQEGMYXEX-PLNGDYQASA-N |
| XLogP | 0.76 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-methyl-N'-propan-2-ylbut-2-ene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-methyl-N'-propan-2-ylbut-2-ene-1,4-diamine?
The IUPAC name of (Z)-N-methyl-N'-propan-2-ylbut-2-ene-1,4-diamine (CID 171552385) is (Z)-N-methyl-N'-propan-2-ylbut-2-ene-1,4-diamine.
What is the SMILES notation for (Z)-N-methyl-N'-propan-2-ylbut-2-ene-1,4-diamine?
The canonical SMILES for (Z)-N-methyl-N'-propan-2-ylbut-2-ene-1,4-diamine is CNC/C=C\CNC(C)C.
What is the InChIKey of (Z)-N-methyl-N'-propan-2-ylbut-2-ene-1,4-diamine?
The InChIKey is SAOMEPQEGMYXEX-PLNGDYQASA-N. The full InChI is InChI=1S/C8H18N2/c1-8(2)10-7-5-4-6-9-3/h4-5,8-10H,6-7H2,1-3H3/b5-4-.
What are the key properties of (Z)-N-methyl-N'-propan-2-ylbut-2-ene-1,4-diamine?
(Z)-N-methyl-N'-propan-2-ylbut-2-ene-1,4-diamine has a molecular weight of 142.25 g/mol, XLogP of 0.76, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-methyl-N'-propan-2-ylbut-2-ene-1,4-diamine is sourced from PubChem (CID 171552385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).