C8H14O — CID 58952970
(2Z,4E)-6-methoxyhepta-2,4-diene (PubChem CID 58952970) has the molecular formula C8H14O and a molecular weight of 126.20 g/mol. Its IUPAC name is (2Z,4E)-6-methoxyhepta-2,4-diene.
| Compound Name | (2Z,4E)-6-methoxyhepta-2,4-diene |
|---|---|
| PubChem CID | 58952970 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | (2Z,4E)-6-methoxyhepta-2,4-diene |
| SMILES | C/C=C\C=C\C(C)OC |
| InChI | InChI=1S/C8H14O/c1-4-5-6-7-8(2)9-3/h4-8H,1-3H3/b5-4-,7-6+ |
| InChIKey | AZTHOSPZOAGEHT-SCFJQAPRSA-N |
| XLogP | 2.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|