C23H28O2 — CID 134379210
1-methoxy-4-[(4Z,6Z)-2-(4-methoxyphenyl)-3-methylocta-4,6-dien-2-yl]benzene (PubChem CID 134379210) has the molecular formula C23H28O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 1-methoxy-4-[(4Z,6Z)-2-(4-methoxyphenyl)-3-methylocta-4,6-dien-2-yl]benzene.
| Compound Name | 1-methoxy-4-[(4Z,6Z)-2-(4-methoxyphenyl)-3-methylocta-4,6-dien-2-yl]benzene |
|---|---|
| PubChem CID | 134379210 |
| Molecular Formula | C23H28O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 1-methoxy-4-[(4Z,6Z)-2-(4-methoxyphenyl)-3-methylocta-4,6-dien-2-yl]benzene |
| SMILES | C/C=C\C=C/C(C)C(C)(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H28O2/c1-6-7-8-9-18(2)23(3,19-10-14-21(24-4)15-11-19)20-12-16-22(25-5)17-13-20/h6-18H,1-5H3/b7-6-,9-8- |
| InChIKey | SJHHCSMADGZKPQ-JPDBVBESSA-N |
| XLogP | 5.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|