C14H18O — CID 144748252
1-[(3Z,5Z)-hepta-3,5-dien-2-yl]oxy-4-methylbenzene (PubChem CID 144748252) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-[(3Z,5Z)-hepta-3,5-dien-2-yl]oxy-4-methylbenzene.
| Compound Name | 1-[(3Z,5Z)-hepta-3,5-dien-2-yl]oxy-4-methylbenzene |
|---|---|
| PubChem CID | 144748252 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 1-[(3Z,5Z)-hepta-3,5-dien-2-yl]oxy-4-methylbenzene |
| SMILES | C/C=C\C=C/C(C)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C14H18O/c1-4-5-6-7-13(3)15-14-10-8-12(2)9-11-14/h4-11,13H,1-3H3/b5-4-,7-6- |
| InChIKey | CVTYZGCERVCCQU-RZSVFLSASA-N |
| XLogP | 3.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|