About 1-[(3Z,5Z)-hepta-3,5-dien-2-yl]oxy-4-methylbenzene
1-[(3Z,5Z)-hepta-3,5-dien-2-yl]oxy-4-methylbenzene (PubChem CID 144748252) has the molecular formula C14H18O
and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-[(3Z,5Z)-hepta-3,5-dien-2-yl]oxy-4-methylbenzene.
Molecular Properties
| Compound Name | 1-[(3Z,5Z)-hepta-3,5-dien-2-yl]oxy-4-methylbenzene |
| PubChem CID | 144748252 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 1-[(3Z,5Z)-hepta-3,5-dien-2-yl]oxy-4-methylbenzene |
| SMILES | C/C=C\C=C/C(C)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C14H18O/c1-4-5-6-7-13(3)15-14-10-8-12(2)9-11-14/h4-11,13H,1-3H3/b5-4-,7-6- |
| InChIKey | CVTYZGCERVCCQU-RZSVFLSASA-N |
| XLogP | 3.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3Z,5Z)-hepta-3,5-dien-2-yl]oxy-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3Z,5Z)-hepta-3,5-dien-2-yl]oxy-4-methylbenzene?
The IUPAC name of 1-[(3Z,5Z)-hepta-3,5-dien-2-yl]oxy-4-methylbenzene (CID 144748252) is 1-[(3Z,5Z)-hepta-3,5-dien-2-yl]oxy-4-methylbenzene.
What is the SMILES notation for 1-[(3Z,5Z)-hepta-3,5-dien-2-yl]oxy-4-methylbenzene?
The canonical SMILES for 1-[(3Z,5Z)-hepta-3,5-dien-2-yl]oxy-4-methylbenzene is C/C=C\C=C/C(C)Oc1ccc(C)cc1.
What is the InChIKey of 1-[(3Z,5Z)-hepta-3,5-dien-2-yl]oxy-4-methylbenzene?
The InChIKey is CVTYZGCERVCCQU-RZSVFLSASA-N. The full InChI is InChI=1S/C14H18O/c1-4-5-6-7-13(3)15-14-10-8-12(2)9-11-14/h4-11,13H,1-3H3/b5-4-,7-6-.
What are the key properties of 1-[(3Z,5Z)-hepta-3,5-dien-2-yl]oxy-4-methylbenzene?
1-[(3Z,5Z)-hepta-3,5-dien-2-yl]oxy-4-methylbenzene has a molecular weight of 202.30 g/mol, XLogP of 3.89, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3Z,5Z)-hepta-3,5-dien-2-yl]oxy-4-methylbenzene is sourced from PubChem (CID 144748252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).