C2H4F2S — CID 56985558
1,2-difluoroethanethiol (PubChem CID 56985558) has the molecular formula C2H4F2S and a molecular weight of 98.12 g/mol. Its IUPAC name is 1,2-difluoroethanethiol.
| Compound Name | 1,2-difluoroethanethiol |
|---|---|
| PubChem CID | 56985558 |
| Molecular Formula | C2H4F2S |
| Molecular Weight | 98.12 g/mol |
| Exact Mass | 98.00 |
| IUPAC Name | 1,2-difluoroethanethiol |
| SMILES | FCC(F)S |
| InChI | InChI=1S/C2H4F2S/c3-1-2(4)5/h2,5H,1H2 |
| InChIKey | GIESGYZEMFEGNE-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 98.12 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|