C13H13F15S — CID 87159417
1,7,8,8,8-pentafluoro-5-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-7-(trifluoromethyl)octane-1-thiol (PubChem CID 87159417) has the molecular formula C13H13F15S and a molecular weight of 486.28 g/mol. Its IUPAC name is 1,7,8,8,8-pentafluoro-5-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-7-(trifluoromethyl)octane-1-thiol.
| Compound Name | 1,7,8,8,8-pentafluoro-5-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-7-(trifluoromethyl)octane-1-thiol |
|---|---|
| PubChem CID | 87159417 |
| Molecular Formula | C13H13F15S |
| Molecular Weight | 486.28 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | 1,7,8,8,8-pentafluoro-5-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-7-(trifluoromethyl)octane-1-thiol |
| SMILES | FC(S)CCCC(CC(F)(C(F)(F)F)C(F)(F)F)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H13F15S/c14-7(29)3-1-2-6(4-8(15,10(17,18)19)11(20,21)22)5-9(16,12(23,24)25)13(26,27)28/h6-7,29H,1-5H2 |
| InChIKey | GDGCIRMCRCZWRX-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.28 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|