C13H13F14U- — CID 159332832
1,1,1,2,9,10,10,10-octafluoro-4-methanidyl-2,9-bis(trifluoromethyl)decane;uranium (PubChem CID 159332832) has the molecular formula C13H13F14U- and a molecular weight of 673.25 g/mol. Its IUPAC name is 1,1,1,2,9,10,10,10-octafluoro-4-methanidyl-2,9-bis(trifluoromethyl)decane;uranium.
| Compound Name | 1,1,1,2,9,10,10,10-octafluoro-4-methanidyl-2,9-bis(trifluoromethyl)decane;uranium |
|---|---|
| PubChem CID | 159332832 |
| Molecular Formula | C13H13F14U- |
| Molecular Weight | 673.25 g/mol |
| Exact Mass | 673.13 |
| IUPAC Name | 1,1,1,2,9,10,10,10-octafluoro-4-methanidyl-2,9-bis(trifluoromethyl)decane;uranium |
| SMILES | [CH2-]C(CCCCC(F)(C(F)(F)F)C(F)(F)F)CC(F)(C(F)(F)F)C(F)(F)F.[U] |
| InChI | InChI=1S/C13H13F14.U/c1-7(6-9(15,12(22,23)24)13(25,26)27)4-2-3-5-8(14,10(16,17)18)11(19,20)21;/h7H,1-6H2;/q-1; |
| InChIKey | WPBPRPPJWJQCPD-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.25 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|