C10H14F7U- — CID 147368980
1,1,1,2-tetrafluoro-2-(trifluoromethyl)nonane;uranium (PubChem CID 147368980) has the molecular formula C10H14F7U- and a molecular weight of 505.24 g/mol. Its IUPAC name is 1,1,1,2-tetrafluoro-2-(trifluoromethyl)nonane;uranium.
| Compound Name | 1,1,1,2-tetrafluoro-2-(trifluoromethyl)nonane;uranium |
|---|---|
| PubChem CID | 147368980 |
| Molecular Formula | C10H14F7U- |
| Molecular Weight | 505.24 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | 1,1,1,2-tetrafluoro-2-(trifluoromethyl)nonane;uranium |
| SMILES | [CH2-]CCCCCCC(F)(C(F)(F)F)C(F)(F)F.[U] |
| InChI | InChI=1S/C10H14F7.U/c1-2-3-4-5-6-7-8(11,9(12,13)14)10(15,16)17;/h1-7H2;/q-1; |
| InChIKey | REVILENUUFQMDY-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.24 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|