C9H19O2Ti-2 — CID 175999811
2,2-dimethylheptane;oxido(oxo)titanium (PubChem CID 175999811) has the molecular formula C9H19O2Ti-2 and a molecular weight of 207.12 g/mol. Its IUPAC name is 2,2-dimethylheptane;oxido(oxo)titanium.
| Compound Name | 2,2-dimethylheptane;oxido(oxo)titanium |
|---|---|
| PubChem CID | 175999811 |
| Molecular Formula | C9H19O2Ti-2 |
| Molecular Weight | 207.12 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 2,2-dimethylheptane;oxido(oxo)titanium |
| SMILES | O=[Ti][O-].[CH2-]CCCCC(C)(C)C |
| InChI | InChI=1S/C9H19.2O.Ti/c1-5-6-7-8-9(2,3)4;;;/h1,5-8H2,2-4H3;;;/q-1;;-1; |
| InChIKey | JTQSPRDUDRDLJC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.12 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|