C11H26 — CID 169194475
molecular hydrogen;2,2,6,6-tetramethylheptane (PubChem CID 169194475) has the molecular formula C11H26 and a molecular weight of 158.33 g/mol. Its IUPAC name is molecular hydrogen;2,2,6,6-tetramethylheptane.
| Compound Name | molecular hydrogen;2,2,6,6-tetramethylheptane |
|---|---|
| PubChem CID | 169194475 |
| Molecular Formula | C11H26 |
| Molecular Weight | 158.33 g/mol |
| Exact Mass | 158.20 |
| IUPAC Name | molecular hydrogen;2,2,6,6-tetramethylheptane |
| SMILES | CC(C)(C)CCCC(C)(C)C.[H][H] |
| InChI | InChI=1S/C11H24.H2/c1-10(2,3)8-7-9-11(4,5)6;/h7-9H2,1-6H3;1H |
| InChIKey | YCYYSUMJIXJDEU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.33 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |