C11H26O4S — CID 175200152
sulfuric acid;2,2,6,6-tetramethylheptane (PubChem CID 175200152) has the molecular formula C11H26O4S and a molecular weight of 254.39 g/mol. Its IUPAC name is sulfuric acid;2,2,6,6-tetramethylheptane.
| Compound Name | sulfuric acid;2,2,6,6-tetramethylheptane |
|---|---|
| PubChem CID | 175200152 |
| Molecular Formula | C11H26O4S |
| Molecular Weight | 254.39 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | sulfuric acid;2,2,6,6-tetramethylheptane |
| SMILES | CC(C)(C)CCCC(C)(C)C.O=S(=O)(O)O |
| InChI | InChI=1S/C11H24.H2O4S/c1-10(2,3)8-7-9-11(4,5)6;1-5(2,3)4/h7-9H2,1-6H3;(H2,1,2,3,4) |
| InChIKey | RPAQKXVYCONEFF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|