C13H21F7O3 — CID 58901210
2-[2-[7,8,8,8-tetrafluoro-7-(trifluoromethyl)octoxy]ethoxy]ethanol (PubChem CID 58901210) has the molecular formula C13H21F7O3 and a molecular weight of 358.29 g/mol. Its IUPAC name is 2-[2-[7,8,8,8-tetrafluoro-7-(trifluoromethyl)octoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[7,8,8,8-tetrafluoro-7-(trifluoromethyl)octoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 58901210 |
| Molecular Formula | C13H21F7O3 |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2-[2-[7,8,8,8-tetrafluoro-7-(trifluoromethyl)octoxy]ethoxy]ethanol |
| SMILES | OCCOCCOCCCCCCC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H21F7O3/c14-11(12(15,16)17,13(18,19)20)5-3-1-2-4-7-22-9-10-23-8-6-21/h21H,1-10H2 |
| InChIKey | YVUKKPSVPIWESN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|