C10H12F10S — CID 143638102
7,8,8,8-tetrafluoro-3,7-bis(trifluoromethyl)octane-1-thiol (PubChem CID 143638102) has the molecular formula C10H12F10S and a molecular weight of 354.25 g/mol. Its IUPAC name is 7,8,8,8-tetrafluoro-3,7-bis(trifluoromethyl)octane-1-thiol.
| Compound Name | 7,8,8,8-tetrafluoro-3,7-bis(trifluoromethyl)octane-1-thiol |
|---|---|
| PubChem CID | 143638102 |
| Molecular Formula | C10H12F10S |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 7,8,8,8-tetrafluoro-3,7-bis(trifluoromethyl)octane-1-thiol |
| SMILES | FC(F)(F)C(CCS)CCCC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H12F10S/c11-7(9(15,16)17,10(18,19)20)4-1-2-6(3-5-21)8(12,13)14/h6,21H,1-5H2 |
| InChIKey | MOKKSAIKYBSRLR-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|