C10H10F12S — CID 59721664
3,3,7,8,8,8-hexafluoro-5,7-bis(trifluoromethyl)octane-1-thiol (PubChem CID 59721664) has the molecular formula C10H10F12S and a molecular weight of 390.23 g/mol. Its IUPAC name is 3,3,7,8,8,8-hexafluoro-5,7-bis(trifluoromethyl)octane-1-thiol.
| Compound Name | 3,3,7,8,8,8-hexafluoro-5,7-bis(trifluoromethyl)octane-1-thiol |
|---|---|
| PubChem CID | 59721664 |
| Molecular Formula | C10H10F12S |
| Molecular Weight | 390.23 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 3,3,7,8,8,8-hexafluoro-5,7-bis(trifluoromethyl)octane-1-thiol |
| SMILES | FC(F)(CCS)CC(CC(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H10F12S/c11-6(12,1-2-23)3-5(8(14,15)16)4-7(13,9(17,18)19)10(20,21)22/h5,23H,1-4H2 |
| InChIKey | SYUIMFKMAHHRLV-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.23 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|