C16H13F20I — CID 59721653
1,1,1,2,4,4,6,6,13,13,13-undecafluoro-12-iodo-2,8,10-tris(trifluoromethyl)tridecane (PubChem CID 59721653) has the molecular formula C16H13F20I and a molecular weight of 712.14 g/mol. Its IUPAC name is 1,1,1,2,4,4,6,6,13,13,13-undecafluoro-12-iodo-2,8,10-tris(trifluoromethyl)tridecane.
| Compound Name | 1,1,1,2,4,4,6,6,13,13,13-undecafluoro-12-iodo-2,8,10-tris(trifluoromethyl)tridecane |
|---|---|
| PubChem CID | 59721653 |
| Molecular Formula | C16H13F20I |
| Molecular Weight | 712.14 g/mol |
| Exact Mass | 711.97 |
| IUPAC Name | 1,1,1,2,4,4,6,6,13,13,13-undecafluoro-12-iodo-2,8,10-tris(trifluoromethyl)tridecane |
| SMILES | FC(F)(CC(CC(CC(I)C(F)(F)F)C(F)(F)F)C(F)(F)F)CC(F)(F)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H13F20I/c17-9(18,4-10(19,20)5-11(21,15(31,32)33)16(34,35)36)3-7(13(25,26)27)1-6(12(22,23)24)2-8(37)14(28,29)30/h6-8H,1-5H2 |
| InChIKey | RPBONWBLTLTKED-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.14 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|