C15H23F12N2O+ — CID 89380907
3-[[5,5,7,8,8,8-hexafluoro-3,7-bis(trifluoromethyl)octyl]amino]propyl-hydroxy-dimethylazanium (PubChem CID 89380907) has the molecular formula C15H23F12N2O+ and a molecular weight of 475.34 g/mol. Its IUPAC name is 3-[[5,5,7,8,8,8-hexafluoro-3,7-bis(trifluoromethyl)octyl]amino]propyl-hydroxy-dimethylazanium.
| Compound Name | 3-[[5,5,7,8,8,8-hexafluoro-3,7-bis(trifluoromethyl)octyl]amino]propyl-hydroxy-dimethylazanium |
|---|---|
| PubChem CID | 89380907 |
| Molecular Formula | C15H23F12N2O+ |
| Molecular Weight | 475.34 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 3-[[5,5,7,8,8,8-hexafluoro-3,7-bis(trifluoromethyl)octyl]amino]propyl-hydroxy-dimethylazanium |
| SMILES | C[N+](C)(O)CCCNCCC(CC(F)(F)CC(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H23F12N2O/c1-29(2,30)7-3-5-28-6-4-10(13(19,20)21)8-11(16,17)9-12(18,14(22,23)24)15(25,26)27/h10,28,30H,3-9H2,1-2H3/q+1 |
| InChIKey | HDDFOTHOYRWWQL-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.34 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|