C9H14F7N2O2+ — CID 163324496
3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)propyl-hydroxy-dimethylazanium (PubChem CID 163324496) has the molecular formula C9H14F7N2O2+ and a molecular weight of 315.21 g/mol. Its IUPAC name is 3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)propyl-hydroxy-dimethylazanium.
| Compound Name | 3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)propyl-hydroxy-dimethylazanium |
|---|---|
| PubChem CID | 163324496 |
| Molecular Formula | C9H14F7N2O2+ |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 3-(2,2,3,3,4,4,4-heptafluorobutanoylamino)propyl-hydroxy-dimethylazanium |
| SMILES | C[N+](C)(O)CCCNC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H13F7N2O2/c1-18(2,20)5-3-4-17-6(19)7(10,11)8(12,13)9(14,15)16/h20H,3-5H2,1-2H3/p+1 |
| InChIKey | SEOLKQFIWTZCMP-UHFFFAOYSA-O |
| XLogP | 1.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|