C13H13F15N2O3 — CID 165364255
N,N-dimethyl-3-[[2,2,3,3-tetrafluoro-3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentoxy)propanoyl]amino]propan-1-amine oxide (PubChem CID 165364255) has the molecular formula C13H13F15N2O3 and a molecular weight of 530.23 g/mol. Its IUPAC name is N,N-dimethyl-3-[[2,2,3,3-tetrafluoro-3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentoxy)propanoyl]amino]propan-1-amine oxide.
| Compound Name | N,N-dimethyl-3-[[2,2,3,3-tetrafluoro-3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentoxy)propanoyl]amino]propan-1-amine oxide |
|---|---|
| PubChem CID | 165364255 |
| Molecular Formula | C13H13F15N2O3 |
| Molecular Weight | 530.23 g/mol |
| Exact Mass | 530.07 |
| IUPAC Name | N,N-dimethyl-3-[[2,2,3,3-tetrafluoro-3-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentoxy)propanoyl]amino]propan-1-amine oxide |
| SMILES | C[N+](C)([O-])CCCNC(=O)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H13F15N2O3/c1-30(2,32)5-3-4-29-6(31)7(14,15)12(25,26)33-13(27,28)10(20,21)8(16,17)9(18,19)11(22,23)24/h3-5H2,1-2H3,(H,29,31) |
| InChIKey | VLBIYENZQLTYEC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.23 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|