C17H13F24N3O2 — CID 129185141
3-[[2-[[bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)amino]-difluoromethyl]-2,3,3,3-tetrafluoropropanoyl]amino]-N,N-dimethylpropan-1-amine oxide (PubChem CID 129185141) has the molecular formula C17H13F24N3O2 and a molecular weight of 747.26 g/mol. Its IUPAC name is 3-[[2-[[bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)amino]-difluoromethyl]-2,3,3,3-tetrafluoropropanoyl]amino]-N,N-dimethylpropan-1-amine oxide.
| Compound Name | 3-[[2-[[bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)amino]-difluoromethyl]-2,3,3,3-tetrafluoropropanoyl]amino]-N,N-dimethylpropan-1-amine oxide |
|---|---|
| PubChem CID | 129185141 |
| Molecular Formula | C17H13F24N3O2 |
| Molecular Weight | 747.26 g/mol |
| Exact Mass | 747.06 |
| IUPAC Name | 3-[[2-[[bis(1,1,2,2,3,3,4,4,4-nonafluorobutyl)amino]-difluoromethyl]-2,3,3,3-tetrafluoropropanoyl]amino]-N,N-dimethylpropan-1-amine oxide |
| SMILES | C[N+](C)([O-])CCCNC(=O)C(F)(C(F)(F)F)C(F)(F)N(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H13F24N3O2/c1-44(2,46)5-3-4-42-6(45)7(18,12(27,28)29)15(36,37)43(16(38,39)10(23,24)8(19,20)13(30,31)32)17(40,41)11(25,26)9(21,22)14(33,34)35/h3-5H2,1-2H3,(H,42,45) |
| InChIKey | BTJQRCVQGGHHGG-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.26 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|