C17H25ClF14N2O2S — CID 161414341
trimethyl-[3-[[5,5,8,8,8-pentafluoro-3,7,7-tris(trifluoromethyl)octyl]sulfonylamino]propyl]azanium chloride (PubChem CID 161414341) has the molecular formula C17H25ClF14N2O2S and a molecular weight of 622.89 g/mol. Its IUPAC name is trimethyl-[3-[[5,5,8,8,8-pentafluoro-3,7,7-tris(trifluoromethyl)octyl]sulfonylamino]propyl]azanium chloride.
| Compound Name | trimethyl-[3-[[5,5,8,8,8-pentafluoro-3,7,7-tris(trifluoromethyl)octyl]sulfonylamino]propyl]azanium chloride |
|---|---|
| PubChem CID | 161414341 |
| Molecular Formula | C17H25ClF14N2O2S |
| Molecular Weight | 622.89 g/mol |
| Exact Mass | 622.11 |
| IUPAC Name | trimethyl-[3-[[5,5,8,8,8-pentafluoro-3,7,7-tris(trifluoromethyl)octyl]sulfonylamino]propyl]azanium chloride |
| SMILES | C[N+](C)(C)CCCNS(=O)(=O)CCC(CC(F)(F)CC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)C(F)(F)F.[Cl-] |
| InChI | InChI=1S/C17H25F14N2O2S.ClH/c1-33(2,3)7-4-6-32-36(34,35)8-5-11(14(20,21)22)9-12(18,19)10-13(15(23,24)25,16(26,27)28)17(29,30)31;/h11,32H,4-10H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | JLBGXMZEVHLKQE-UHFFFAOYSA-M |
| XLogP | 2.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.89 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|