C16H15F17 — CID 58419060
(Z)-1,1,1,8,8,10,10,12,13,13,13-undecafluoro-12-methyl-4,6-bis(trifluoromethyl)tridec-2-ene (PubChem CID 58419060) has the molecular formula C16H15F17 and a molecular weight of 530.26 g/mol. Its IUPAC name is (Z)-1,1,1,8,8,10,10,12,13,13,13-undecafluoro-12-methyl-4,6-bis(trifluoromethyl)tridec-2-ene.
| Compound Name | (Z)-1,1,1,8,8,10,10,12,13,13,13-undecafluoro-12-methyl-4,6-bis(trifluoromethyl)tridec-2-ene |
|---|---|
| PubChem CID | 58419060 |
| Molecular Formula | C16H15F17 |
| Molecular Weight | 530.26 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | (Z)-1,1,1,8,8,10,10,12,13,13,13-undecafluoro-12-methyl-4,6-bis(trifluoromethyl)tridec-2-ene |
| SMILES | CC(F)(CC(F)(F)CC(F)(F)CC(CC(/C=C\C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H15F17/c1-10(17,16(31,32)33)6-12(20,21)7-11(18,19)5-9(15(28,29)30)4-8(14(25,26)27)2-3-13(22,23)24/h2-3,8-9H,4-7H2,1H3/b3-2- |
| InChIKey | UGYHLIWQAUKLMH-IHWYPQMZSA-N |
| XLogP | 8.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.26 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|