C16H26F8O — CID 89292991
8,8,10,10,12,13,13,13-octafluoro-4,6,12-trimethyltridecan-2-ol (PubChem CID 89292991) has the molecular formula C16H26F8O and a molecular weight of 386.37 g/mol. Its IUPAC name is 8,8,10,10,12,13,13,13-octafluoro-4,6,12-trimethyltridecan-2-ol.
| Compound Name | 8,8,10,10,12,13,13,13-octafluoro-4,6,12-trimethyltridecan-2-ol |
|---|---|
| PubChem CID | 89292991 |
| Molecular Formula | C16H26F8O |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 8,8,10,10,12,13,13,13-octafluoro-4,6,12-trimethyltridecan-2-ol |
| SMILES | CC(O)CC(C)CC(C)CC(F)(F)CC(F)(F)CC(C)(F)C(F)(F)F |
| InChI | InChI=1S/C16H26F8O/c1-10(6-12(3)25)5-11(2)7-14(18,19)9-15(20,21)8-13(4,17)16(22,23)24/h10-12,25H,5-9H2,1-4H3 |
| InChIKey | ANOJMRWWLLWXND-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |