C24H27F21 — CID 91535959
6,7,7,7-tetrafluoro-4-(2-fluoro-2-methylpropyl)-6-(trifluoromethyl)hept-1-ene;8,9,9,9-tetrafluoro-4,6,8-tris(trifluoromethyl)non-1-ene (PubChem CID 91535959) has the molecular formula C24H27F21 and a molecular weight of 714.44 g/mol. Its IUPAC name is 6,7,7,7-tetrafluoro-4-(2-fluoro-2-methylpropyl)-6-(trifluoromethyl)hept-1-ene;8,9,9,9-tetrafluoro-4,6,8-tris(trifluoromethyl)non-1-ene.
| Compound Name | 6,7,7,7-tetrafluoro-4-(2-fluoro-2-methylpropyl)-6-(trifluoromethyl)hept-1-ene;8,9,9,9-tetrafluoro-4,6,8-tris(trifluoromethyl)non-1-ene |
|---|---|
| PubChem CID | 91535959 |
| Molecular Formula | C24H27F21 |
| Molecular Weight | 714.44 g/mol |
| Exact Mass | 714.18 |
| IUPAC Name | 6,7,7,7-tetrafluoro-4-(2-fluoro-2-methylpropyl)-6-(trifluoromethyl)hept-1-ene;8,9,9,9-tetrafluoro-4,6,8-tris(trifluoromethyl)non-1-ene |
| SMILES | C=CCC(CC(C)(C)F)CC(F)(C(F)(F)F)C(F)(F)F.C=CCC(CC(CC(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H11F13.C12H16F8/c1-2-3-6(9(14,15)16)4-7(10(17,18)19)5-8(13,11(20,21)22)12(23,24)25;1-4-5-8(6-9(2,3)13)7-10(14,11(15,16)17)12(18,19)20/h2,6-7H,1,3-5H2;4,8H,1,5-7H2,2-3H3 |
| InChIKey | NXFUFAQEJXVJSS-UHFFFAOYSA-N |
| XLogP | 12.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.44 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|