C12H16F8 — CID 58901154
6,7,7,7-tetrafluoro-4-(2-fluoro-2-methylpropyl)-6-(trifluoromethyl)hept-1-ene (PubChem CID 58901154) has the molecular formula C12H16F8 and a molecular weight of 312.24 g/mol. Its IUPAC name is 6,7,7,7-tetrafluoro-4-(2-fluoro-2-methylpropyl)-6-(trifluoromethyl)hept-1-ene.
| Compound Name | 6,7,7,7-tetrafluoro-4-(2-fluoro-2-methylpropyl)-6-(trifluoromethyl)hept-1-ene |
|---|---|
| PubChem CID | 58901154 |
| Molecular Formula | C12H16F8 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 6,7,7,7-tetrafluoro-4-(2-fluoro-2-methylpropyl)-6-(trifluoromethyl)hept-1-ene |
| SMILES | C=CCC(CC(C)(C)F)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H16F8/c1-4-5-8(6-9(2,3)13)7-10(14,11(15,16)17)12(18,19)20/h4,8H,1,5-7H2,2-3H3 |
| InChIKey | JJXDWCFRXIXTHP-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|