C11H13F7O — CID 20760669
1,1,1,6-tetrafluoro-4-prop-2-enyl-2-(trifluoromethyl)hept-6-en-2-ol (PubChem CID 20760669) has the molecular formula C11H13F7O and a molecular weight of 294.21 g/mol. Its IUPAC name is 1,1,1,6-tetrafluoro-4-prop-2-enyl-2-(trifluoromethyl)hept-6-en-2-ol.
| Compound Name | 1,1,1,6-tetrafluoro-4-prop-2-enyl-2-(trifluoromethyl)hept-6-en-2-ol |
|---|---|
| PubChem CID | 20760669 |
| Molecular Formula | C11H13F7O |
| Molecular Weight | 294.21 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 1,1,1,6-tetrafluoro-4-prop-2-enyl-2-(trifluoromethyl)hept-6-en-2-ol |
| SMILES | C=CCC(CC(=C)F)CC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H13F7O/c1-3-4-8(5-7(2)12)6-9(19,10(13,14)15)11(16,17)18/h3,8,19H,1-2,4-6H2 |
| InChIKey | RPWHASWDXHXQMA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.21 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|