C9H14F6O — CID 89360060
4-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-ol (PubChem CID 89360060) has the molecular formula C9H14F6O and a molecular weight of 252.20 g/mol. Its IUPAC name is 4-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-ol.
| Compound Name | 4-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-ol |
|---|---|
| PubChem CID | 89360060 |
| Molecular Formula | C9H14F6O |
| Molecular Weight | 252.20 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 4-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-ol |
| SMILES | CCC(CC)CC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H14F6O/c1-3-6(4-2)5-7(16,8(10,11)12)9(13,14)15/h6,16H,3-5H2,1-2H3 |
| InChIKey | QCCMBOFFERLUDY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.20 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |