About 4-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-ol
4-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-ol (PubChem CID 89360060) has the molecular formula C9H14F6O
and a molecular weight of 252.20 g/mol. Its IUPAC name is 4-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-ol.
Molecular Properties
| Compound Name | 4-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-ol |
| PubChem CID | 89360060 |
| Molecular Formula | C9H14F6O |
| Molecular Weight | 252.20 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 4-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-ol |
| SMILES | CCC(CC)CC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H14F6O/c1-3-6(4-2)5-7(16,8(10,11)12)9(13,14)15/h6,16H,3-5H2,1-2H3 |
| InChIKey | QCCMBOFFERLUDY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.20 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-ol?
The IUPAC name of 4-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-ol (CID 89360060) is 4-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-ol.
What is the SMILES notation for 4-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-ol?
The canonical SMILES for 4-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-ol is CCC(CC)CC(O)(C(F)(F)F)C(F)(F)F.
What is the InChIKey of 4-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-ol?
The InChIKey is QCCMBOFFERLUDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F6O/c1-3-6(4-2)5-7(16,8(10,11)12)9(13,14)15/h6,16H,3-5H2,1-2H3.
What are the key properties of 4-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-ol?
4-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-ol has a molecular weight of 252.20 g/mol, XLogP of 3.67, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-ol is sourced from PubChem (CID 89360060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).