C14H18F12O3 — CID 59752417
1,1,1,7,7,7-hexafluoro-4-(2-methylbutoxy)-2,6-bis(trifluoromethyl)heptane-2,6-diol (PubChem CID 59752417) has the molecular formula C14H18F12O3 and a molecular weight of 462.27 g/mol. Its IUPAC name is 1,1,1,7,7,7-hexafluoro-4-(2-methylbutoxy)-2,6-bis(trifluoromethyl)heptane-2,6-diol.
| Compound Name | 1,1,1,7,7,7-hexafluoro-4-(2-methylbutoxy)-2,6-bis(trifluoromethyl)heptane-2,6-diol |
|---|---|
| PubChem CID | 59752417 |
| Molecular Formula | C14H18F12O3 |
| Molecular Weight | 462.27 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 1,1,1,7,7,7-hexafluoro-4-(2-methylbutoxy)-2,6-bis(trifluoromethyl)heptane-2,6-diol |
| SMILES | CCC(C)COC(CC(O)(C(F)(F)F)C(F)(F)F)CC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H18F12O3/c1-3-7(2)6-29-8(4-9(27,11(15,16)17)12(18,19)20)5-10(28,13(21,22)23)14(24,25)26/h7-8,27-28H,3-6H2,1-2H3 |
| InChIKey | SHKVSJGEPQGKOD-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.27 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |