C8H12F6O — CID 137421832
3-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)pentan-2-ol (PubChem CID 137421832) has the molecular formula C8H12F6O and a molecular weight of 238.17 g/mol. Its IUPAC name is 3-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)pentan-2-ol.
| Compound Name | 3-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)pentan-2-ol |
|---|---|
| PubChem CID | 137421832 |
| Molecular Formula | C8H12F6O |
| Molecular Weight | 238.17 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 3-ethyl-1,1,1-trifluoro-2-(trifluoromethyl)pentan-2-ol |
| SMILES | CCC(CC)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H12F6O/c1-3-5(4-2)6(15,7(9,10)11)8(12,13)14/h5,15H,3-4H2,1-2H3 |
| InChIKey | UMXMKGFMPWZPKW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.17 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |