C11H21F3O2 — CID 123178182
4-ethyl-1,1,1-trifluoro-5,5-dimethylheptane-2,2-diol (PubChem CID 123178182) has the molecular formula C11H21F3O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 4-ethyl-1,1,1-trifluoro-5,5-dimethylheptane-2,2-diol.
| Compound Name | 4-ethyl-1,1,1-trifluoro-5,5-dimethylheptane-2,2-diol |
|---|---|
| PubChem CID | 123178182 |
| Molecular Formula | C11H21F3O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 4-ethyl-1,1,1-trifluoro-5,5-dimethylheptane-2,2-diol |
| SMILES | CCC(CC(O)(O)C(F)(F)F)C(C)(C)CC |
| InChI | InChI=1S/C11H21F3O2/c1-5-8(9(3,4)6-2)7-10(15,16)11(12,13)14/h8,15-16H,5-7H2,1-4H3 |
| InChIKey | AODSMKBHKIAXPA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|