C9H17F3O2 — CID 147451457
(4S)-4-ethyl-1,1,1-trifluoro-5-methylhexane-2,2-diol (PubChem CID 147451457) has the molecular formula C9H17F3O2 and a molecular weight of 214.23 g/mol. Its IUPAC name is (4S)-4-ethyl-1,1,1-trifluoro-5-methylhexane-2,2-diol.
| Compound Name | (4S)-4-ethyl-1,1,1-trifluoro-5-methylhexane-2,2-diol |
|---|---|
| PubChem CID | 147451457 |
| Molecular Formula | C9H17F3O2 |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | (4S)-4-ethyl-1,1,1-trifluoro-5-methylhexane-2,2-diol |
| SMILES | CC[C@@H](CC(O)(O)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C9H17F3O2/c1-4-7(6(2)3)5-8(13,14)9(10,11)12/h6-7,13-14H,4-5H2,1-3H3/t7-/m0/s1 |
| InChIKey | DYDKSSXLTDJHGI-ZETCQYMHSA-N |
| XLogP | 2.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|