About 3,5-diethyl-3,4-dimethyl-4-(trifluoromethyl)heptane
3,5-diethyl-3,4-dimethyl-4-(trifluoromethyl)heptane (PubChem CID 166589252) has the molecular formula C14H27F3
and a molecular weight of 252.36 g/mol. Its IUPAC name is 3,5-diethyl-3,4-dimethyl-4-(trifluoromethyl)heptane.
Analyze 3,5-diethyl-3,4-dimethyl-4-(trifluoromethyl)heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diethyl-3,4-dimethyl-4-(trifluoromethyl)heptane?
The IUPAC name of 3,5-diethyl-3,4-dimethyl-4-(trifluoromethyl)heptane (CID 166589252) is 3,5-diethyl-3,4-dimethyl-4-(trifluoromethyl)heptane.
What is the SMILES notation for 3,5-diethyl-3,4-dimethyl-4-(trifluoromethyl)heptane?
The canonical SMILES for 3,5-diethyl-3,4-dimethyl-4-(trifluoromethyl)heptane is CCC(CC)C(C)(C(F)(F)F)C(C)(CC)CC.
What is the InChIKey of 3,5-diethyl-3,4-dimethyl-4-(trifluoromethyl)heptane?
The InChIKey is DDZHFFUIOOWSAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27F3/c1-7-11(8-2)13(6,14(15,16)17)12(5,9-3)10-4/h11H,7-10H2,1-6H3.
What are the key properties of 3,5-diethyl-3,4-dimethyl-4-(trifluoromethyl)heptane?
3,5-diethyl-3,4-dimethyl-4-(trifluoromethyl)heptane has a molecular weight of 252.36 g/mol, XLogP of 5.82, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diethyl-3,4-dimethyl-4-(trifluoromethyl)heptane is sourced from PubChem (CID 166589252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).