C11H19F — CID 167182479
2-fluoro-5-propylocta-1,7-diene (PubChem CID 167182479) has the molecular formula C11H19F and a molecular weight of 170.27 g/mol. Its IUPAC name is 2-fluoro-5-propylocta-1,7-diene.
| Compound Name | 2-fluoro-5-propylocta-1,7-diene |
|---|---|
| PubChem CID | 167182479 |
| Molecular Formula | C11H19F |
| Molecular Weight | 170.27 g/mol |
| Exact Mass | 170.15 |
| IUPAC Name | 2-fluoro-5-propylocta-1,7-diene |
| SMILES | C=CCC(CCC)CCC(=C)F |
| InChI | InChI=1S/C11H19F/c1-4-6-11(7-5-2)9-8-10(3)12/h4,11H,1,3,5-9H2,2H3 |
| InChIKey | AVYFPHPQHPMGCN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.27 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|